IIT Mains 2015

Test Name: IIT Mains 2015

Question 1:

Two stones are thrown up simultaneously from the edge of a cliff 240 m high with initial speed of 10 m s-1 and 40 m s-1 respectively. Which of the following graph best represents the time variation of relative position of the second stone with respect to the first? (Assume stones do not rebound after hitting the ground and neglect air resistance, take g = 10 m s-2). (The figures are schematic and not drawn to scale)

Option 1:
Option 2:
Option 3:
Option 4:
Correct Answer: 3

 

Solutions:The displacement of the stones w.r.t to the time t is given by

y=ut-12gt2where y is the displacement, u is the initial velocity of the stone g is acceleration due to gravity

Time required by the first stone to reach the ground, t1 is​

-240=10t1-12×10×t12⇒-240=10t1-5t12⇒5t12-10t1-240=0⇒t1-8t1+6=0⇒t1=8, -6 ∴ t1=8 sTime required by the second stone to reach the ground, t2 is

-240=40t2-12×10×t22⇒5t2-40t2-240=0⇒t2-12t2+8=0⇒t2=12, -8∴t2=12 sFor t = 0 to t = 8 s, both the stones are in air. Thus,

y2-y1=30t⇒y2-y1∝t∴The graph of y2-y1 against t is a straight line for 0≤t≤8After t = 8 s, stone will fall to ground and will remain there. So, y1 = 240 and

y2=40t-12gt2⇒y2-y1=40t-12gt2⇒y2=40t-12gt2-240As stone 2 has acceleration with respect to stone 1. The graph (3) is the correct description.

Hence, the correct answer is option C.

Question 2:

The period of oscillation of a simple pendulum is

T=2πLg.Measured value of L is 20.0 cm known to 1 mm accuracy and time for 100 oscillations of the pendulum is found to be 90 s using a wrist watch of 1 s resolution. The accuracy in the determination of g is

Option 1: 2%
Option 2: 3%
Option 3: 1%
Option 4: 5%
Correct Answer: 2

 

Solutions:

Given, T2=4π2.Lg⇒ g=4π2.LT2Accuracy in determining the value of g can be calculated as:∆gg×100=∆LL×100+2.∆TT×100⇒∆gg×100=0.120×100+2×190×100⇒∆gg×100=2.7 %≃3 %Thus, the accuracy in determination of g is 3%.

Hence, the correct option is (B) [[VIDEO:13819]]

Question 3:

Given in the figure are two blocks A and B of weight 20 N and 100 N, respectively. These are being pressed against a wall by a force F as shown. If the coefficient of friction between the blocks is 0.1 and between block B and the wall is 0.15, the frictional force applied by the wall on block B is:

Option 1: 100 N
Option 2: 80 N
Option 3: 120 N
Option 4: 150 N
Correct Answer: 3

 

Solutions:For the given arrangement, the free body diagram of the two blocks will be given as below:

The frictional force f applied by the wall, will be in upward direction. So, for the system to be in equilibrium,  we have f = 120 N

Hence, the correct option is (3).

[[VIDEO:13820]]

Question 4:

A particle of mass m moving in the x direction with speed 2v is hit by another particle of mass 2m moving in the y direction with speed v. If the collision is perfectly inelastic, the percentage loss in the energy during the collision is close to:

Option 1: 44%
Option 2: 50%
Option 3: 56%
Option 4: 62%
Correct Answer: 3

 

Solutions: As the collision is perfectly inelastic, the momentum will remain conserved. Let vx and vy be the components of final velocity v‘ in x and y directions respectively.

m.2v=m+2mvx⇒vx=23vAlso, applying the conservation of momentum is y direction, we get

2m.v=m+2mvy⇒vy=23vThe resultant velocity after collision will be

v’=vx2+vy2⇒v’=23v2+23v2⇒v’=223vThe kinetic energy, E1 before collison is

E1=12m2v2+122m.v2⇒E1=12m.4v2+mv2⇒E1=2mv2+mv2⇒E1=3mv2The kinetic energy, E2 after collison is ​

E2=123m.22v32⇒E2=32m.8v29=43v2Loss in kinetic energy is given by

E1-E2=3v2-43v2=9v2-4v23=53v2Percentage loss in Kinetic Energy = Loss in Kinetic EnergyInitial Kinetic Energy ×100                                                 =E1-E2E1×100=53v23v2×100⇒Percentage loss=59×100=55.6≈56%Hence, the correct option is (3)

Question 5:

Distance of the centre of mass of a solid uniform cone from its vertex is z0. If the radius of its base is R and its height is h then z0 is equal to:

Option 1: h24R
Option 2: 3h4
Option 3: 5h8
Option 4: 3h28R
Correct Answer: 2

 

Solutions:

Consider a disc of radius, x of width dy at depth y from the vertex point of the cone. Let M be the mass of the cone. ∴ Mass of the disc will be

dm=M13πR2h×πx2dyNow due to symmetry of the triangle OAB and OCD

xy=RH

⇒x=Ryh∴dm=3MπR2h×πRyh2dy⇒dm=3My2h3dyThe location of centre of mass of the disc from the vertex can be calculated as ycm=1M∫dm.y⇒ycm=1M∫3My2h3dy.y∴Location of centre of mass of the cone from the vertex can be calculated as: z0 =1M∫0h3My2h3dy.y⇒z0 =3h3∫0Hy3dy⇒z0=34hHence, the correct option is (2).

[[VIDEO:13822]]

Question 6:

From a solid sphere of mass M and radius R a cube of maximum possible volume is cut. Moment of inertia of cube about an axis passing through its centre and perpendicular to one of its faces is:

Option 1: MR2322π
Option 2: MR2162π
Option 3: 4MR293π
Option 4: 4MR233π
Correct Answer: 3

 

Solutions:

A cube is cut from a sphere of radius R. Let a be the side of cube. If the cube is of maximum volume then, the diagonal of the cube must be equal to the diameter of the sphere. So, we have

3a=2Ra=2R3The volume of sphere is given by,

V=4π3R3The density of the sphere will be d=MV⇒d=M4π3R3=3M4πR3The density of both the cube and the sphere will remain same. Thus, Mass of the cube, M‘ is given by

M’=da3=3M4πR38R333⇒M’=2M3πThe moment of inertia of the cube is

I=M’a26=2M3π×16×2R32⇒I=4MR293πHence, the correct option is (3).

[[VIDEO:13821]]

Question 7:

From a solid sphere of mass M and radius R, a spherical portion of radius

R2is removed, as shown in the figure. Taking gravitational potential V = 0 at r = ∞, the potential at the centre of the cavity thus formed is: (G = gravitational constant)

Option 1: -GM2R
Option 2: -GMR
Option 3: -2GM3R
Option 4: -2GMR
Correct Answer: 2

 

Solutions:

Gravitational potential at the centre of cavity is V = V1 – V2 where V1 is potential at the centre of cavity due to complete sphere of radius R V2 is potential at the centre of cavity due to sphere of radius R/2.

Potential at an internal point of solid sphere at a distance ‘r‘ is given by

V=-GMR32-r22R2To calculate V1

r=R2V1=-GMR32-R28R2=-118GMRTo calculate V2

V2=-32.GM8R2=-38GMR

Net potential, V=V1-V2V=-118GMR+38GMR=-GMRHence, the correct option is (2)

[[VIDEO:13823]]

Question 8:

A pendulum made of a uniform wire of cross sectional area A has time period T. When an additional mass M is added to its bob, the time period changes to TM. If the Young’s modulus of the material of the wire is Y then

1Yis equal to: (g = gravitational acceleration)

Option 1:  TMT2-1AMg
Option 2: TMT2-1MgA
Option 3: 1-TMT2AMg
Option 4: 1-TTM2AMg
Correct Answer: 1

 

Solutions:Time period of a simple pendulum is given by ,

T=2πlg …..(1)where l is length of the simple pendulumg is the acceleration due to gravityOn increasing the mass of the bob, the length of the pendulum increases. Let Δ​l  be the increment in the length of the pendulum Then, new Time period, TM will be

TM=2πl+Δlg …..(2)Dividing (2) by (1), we get

TMT=l+∆ll⇒TMT2=l+∆ll=1+∆ll⇒∆ll=TMT2-1 …..(3)The young modulus, Y​ is given by

Y=FA.lΔlY=MgA.lΔl⇒1Y=AMg.ΔllFrom (3), we get

1Y=AMgTMT2-1Hence, the correct option is (1)

[[VIDEO:13824]]

Question 9:

Consider a spherical shell of radius R at temperature T. The black body radiation inside it can be considered as an ideal gas of photons with internal energy per unit volume

u=UV∝T4and pressure

P=13UV.If the shell now undergoes an adiabatic expansion the relation between T and R is:

Option 1: T∝e-R
Option 2: T∝e-3R
Option 3: T∝1R
Option 4:  T∝1R3
Correct Answer: 3

 

Solutions:Given

P=13UVAlso, UV∝T4Thus, P=13UV =13kT4where k is some constant

For an ideal gas PV=nR1T⇒ P=nR1TV        where R1 is molar gas constantThus, nR1TV∝T4⇒nR1V∝T3⇒1V∝T3or 14π3R3∝T3⇒1R3∝T3T∝1RHence, the correct option is (3)

[[VIDEO:13825]]

Question 10:

A solid of constant heat capacity 1 J/°C is being heated keeping it in contact with reservoirs in two ways: (i) Sequentially keeping in contact with 2 reservoirs such that each reservoir supplies same amount of heat. (ii) Sequentially keeping in contact with 8 reservoirs such that each reservoir supplies same amount of heat. In both the cases body is brought form initial temperature 100°C to final temperature 200°C. Entropy change of the body in the two cases respectively is:

Option 1: ln2, 4ln2
Option 2: ln2, ln2
Option 3: ln2, 2ln2
Option 4: 2ln2, 8ln2
Correct Answer: 2

 

Solutions:Since each reservoir supplies same amount of heat the change in temperature of the body will be equal when kept in contact with both reservoirs. Since it is kept in contact with two reservoirs, the change in temperature will be same and can be calculated as:

Δs=∫T1T2dQT+∫T2T3dQTor⇒Δs=∫T1T2CdTT+∫T2T3CdTT⇒Δs=C∫100150dTT+C∫150200dTT⇒Δs=ClnT100150+ClnT150200⇒Δs=Cln150-ln100+Cln200-ln150⇒Δs=Cln200-ln100=Cln200100=Cln2Similarly, Change in entropy for the system (ii) can be calculated as:

Since it is kept in contact with eight reservoirs such that each reservoir supplies same amount of heat, the change in temperature will be same in each case and can be calculated as

Δs= ∫T1T2dQT+∫T2T3dQT+∫T3T4dQT+∫T4T5dQT+∫T5T6dQT+∫T6T7dQT+∫T7T8dQT+∫T8T9dQT⇒Δs=∫100112.5CdTT+∫112.5125CdTT+∫125137.5CdTT+∫137.5150CdTT+∫150162.5CdTT+∫162.5175CdTT+∫175187.5CdTT+∫187.5200CdTT⇒Δs=ClnT100112.5 +ClnT112.5125 +ClnT125137.50 +ClnT137.5150 +ClnT150162.5 +ClnT162.50175 +ClnT175187.5 +ClnT187.50200 ⇒Δs=Cln112.5-ln100+Cln125-ln112.5+Cln137.5-ln125+Cln150-ln137.5+Cln162.5-ln150+Cln175-ln162.5+Cln187.5-ln175+Cln200-ln187.5⇒Δs=Cln200-ln100=Cln200100=Cln(2)=ln2   ∵C=1 J οC-1Hence, the correct option is (2).

[[VIDEO:13826]]

Question 11:

Consider an ideal gas confined in an isolated closed chamber. As the gas undergoes an adiabatic expansion, the average time of collision between molecules increase as Vq, where V is the volume of the gas. The value of q is :

γ=CpCv

Option 1: 3γ+56
Option 2: 3γ-56
Option 3: γ+12
Option 4: γ-12
Correct Answer: 3

 

Solutions:

The average time of collision is given by, ς=12πd2NV3RTMThus, ς∝VTAs,TVγ-1=K⇒T=KVγ-1⇒ς∝VVγ-1⇒ς∝VVγ-12⇒ς∝V1+γ-12⇒ς∝Vγ+12Hence, the correct option is (3).

[[VIDEO:13827]]

Question 12:

For a simple pendulum, a graph is plotted between its kinetic energy (KE) and potential energy (PE) against its displacement d. Which one of the following represents these correctly? (graph are schematic and not drawn to scale).

Option 1:
Option 2:
Option 3:
Option 4:
Correct Answer: 2

 

Solutions:A simple pendulum performs simple harmonic motion. Potential energy in simple harmonic motion (PE) is given by

PE=12mω2x2Where m = mass of the particle x = displacement from the mean position ω = angular speed of particle

Potential energy is maximum at extreme position, at this position x = A = amplitude of simple harmonic motion

Thus, maximum potential energy will be

PEmax=12mω2A2Thus, potential energy is maximum at extreme position and zero at mean position.

Kinetic energy in simple harmonic motion is given by,

KE=12mω2A2-x2Thus, kinetic energy in simple harmonic motion is maximum at mean position and decreases as we go away from the mean position, becomes zero at extreme position.

Only graph (2) satisfies this condition.

Hence, the correct option is (2).

[[VIDEO:13828]]

Question 13:

A train is moving on a straight track with speed 20 ms−1. It is blowing its whistle at the frequency of 1000 Hz. The percentage change in the frequency heard by a person standing near the track as the train passes him is (speed of sound = 320 ms−1) close to

Option 1: 6 %
Option 2: 12 %
Option 3: 18 %
Option 4: 24 %
Correct Answer: 2

 

Solutions:Given: Speed of train, vs = 20 m s−1 Speed of sound, v = 320 m s−1 Frequency of whistle, f0 = 1000 Hz

As the train coming close to the person, frequency (f1) of the whistle heard by person standing near the track is given by

f1=f0vv-vs⇒ f1=1000×320(320-20)⇒f1=1000×320300=1066.67 HzAs the train goes away from him, the frequency (f2) of the whistle heard by the person is given by

f2=f0vv+vs⇒f2=1000×320320+20⇒f2=1000×320340⇒f2=941.17 Hz Percentage change in frequency, d=f1-f2f1×100%d=1066.67-941.171066.67×100%d=125.41066.67%=11.76%≈12%Hence, the correct answer is option B.

Question 14:

A long cylindrical shell carries positive surface charge σ in the upper half and negative surface charge −σ in the lower half. The electric field lines around the cylinder will look like figure given in : (figure are schematic and not drawn to scale)

Option 1:
Option 2:
Option 3:
Option 4:
Correct Answer: 1

 

Solutions:Electric field lines always start from the positive charge and terminate at the negative charge. Therefore, options (B) and (C) are not possible . Electric field lines are also be smooth curves. Therefore, option (D) is incorrect.

Option (A) satisfies all the properties of electric field lines.

Hence, the correct answer is option A.

 

Question 15:

A uniformly charged solid sphere of radius R has potential V0 (measured with respect to ∞) on its surface. For this sphere the equipotential surfaces with potentials

3V02, 5V04, 3V04and V04have radius R1, R2, R3 and R4 respectively. Then

Option 1: R1 = 0 and R3 > (R4R3)
Option 2: R1 ≠ 0 and (R2R1) > (R4R3)
Option 3: R1 = 0 and R2 < (R4R3)
Option 4: 2R < R4
Correct Answer: 3,4

 

Solutions:Let Q be the charge enclosed by the sphere and R be the radius of the sphere. Potential inside the sphere (Vin) is given by

Vin=Q4πε0R32-r22R2Where r=distance of the point outside the spherePotential on the surface of sphereVS isVS=Q4πε0R=VO         givenPotential outside the sphere isVout=Q4πε0rPotential at the centre of the sphere Vcentre is given byVcentre=k43πR3∫0R4πr2drr⇒V0=32kQR     k=14πε0=32V0∴ R1=0If54VO is possible inside the sphere∴54VO=VO32-r22R2      ∵ r=R2⇒r=R2=R23V04 is possible outside the sphere∴ 3V04=Q4πε0r⇒34Q4πε0=Q4πε0r⇒r=43R=R3Similarly, V04 is possible outside the sphereV04=Q4πε0r⇒r=4R=R4We can see that R2<R4-R3Therefore, the correct option is (3) and (4).

Question 16:

In the given circuit, charge Q2 on the 2 μF capacitor changes as C is varied from 1 μF to 3 μF. Q2 as a function of C is represented by

(Figures are drawn schematically and are not to scale.)

Option 1:
Option 2:
Option 3:
Option 4:
Correct Answer: 2

 

Solutions:Here, 1 μF and 2 μF are in parallel. So, their equivalent capacitance is given by

C’=1+2=3 μFSo, the given circuit is simplified as given below

Now, the capacitances C and C‘ are in series. So, their equivalent capacitance is given by

1Ceqv=1C+13⇒Ceqv=3CC+3The charge flowing through the equivalent capacitance is given by

Q=Ceqv.EThe charge remains the same in the series connection. Therefore, the charge through C and C‘ individually will be equal to Q. But, the total charge distributes in the ratio of capacitances in parallel connection.

The charge Q2 through the capacitance 2 μF is given by

Q2=Q×23=2CEC+3=2E1+3CFor

1≤C≤3, Q2 will increase as E is constant. Also,

dQ2dC=C+32E-2CEC+32⇒dQdC=6EC+32⇒dQdC>0Obtaining the 2nd derivative, we get

d2QdC2=6E-2C+32=-12EC+32⇒d2QdC2<0So, from the second derivative test, we can say that the variation is concave downwards.

Hence, the correct answer is option B.

 

Question 17:

When 5 V potential difference is applied across a wire of length 0.1 m, the drift speed of electrons is 2.5 × 10–4 m s–1. If the electron density in the wire is 8 × 1028 m–3, the resistivity of the material is close to :

Option 1: 1.6 × 10–8 Ωm
Option 2: 1.6 × 10–7 Ωm
Option 3: 1.6 × 10–6 Ωm
Option 4: 1.6 × 10–5 Ωm
Correct Answer: 4

 

Solutions:The drift speed of electrons flowing through the conductor is given by

vd=iAne …..(1)where i is the current through the conductorA is its area of cross sectionn is the electron density through itAlso, the electron density in the wire is given by

j=iA=σE …..(2)where σ is the conductivity of material of conductorE is the Electric field across the length of the conductorFrom (1), we haveiA=nevdFrom (2), we havenevd=σE=σVlwhere V is the applied potential difference across the conductorl is the length of the conductor⇒σ=nevdlVBut, ρ=1σwhere ρ is the resisitivity of the material of the conductor∴ρ=Vnevdl=58×1028×1.6×10-19×2.5×10-4×0.1⇒ρ=1.6×10-5 ΩmHence, the correct option is (D).

[[VIDEO:13832]]

Question 18:

In the circuit shown, the current in the 1 Ω resistor is :

Option 1: 1.3 A, from P to Q
Option 2: 0 A
Option 3: 0.13 A, from Q to P
Option 4: 0.13 A, from P to Q
Correct Answer: 3

 

Solutions:

Apply KVL in loop (I), we get

6i1-i2-9=0⇒9=6i1-i2 …..(1)Now, applying KVL in loop (II), we get

4i2-i1-6=0⇒6=4i2-i1 …..(2)Solving (1) and (2), we get

i1-i2=-0.13 A∴ The current through 1 Ω resistor is 0.13 A from Q to P.

Hence, the correct option is (C).

[[VIDEO:13833]]

Question 19:

Two coaxial solenoids of different radii carry current I in the same direction. Let

F→1be the magnetic force on the inner solenoid due to the outer one and

F→2be the magnetic force on the outer solenoid due to the inner one. Then :

Option 1: F→1=

F→2= 0

Option 2:

F→1is radially inwards and

F→2is radially outwards

Option 3: F→1is radially inwards and

F→2= 0

Option 4: F→1is radially outwards and

F→2= 0

Correct Answer: 1

 

Solutions:For a solenoid having n turns and through which current I is flowing, the magnetic field:

inside the solenoid is given by

B=μ0nIoutside the solenoid is zero

The magnetic field due to the inner coil at external points will be zero. So, the magnetic force on the outer coil

F→2will be zero.

Also, the magnetic field at any current element of the inner coil due to outer coil will be perpendicular to its length. From Fleming’s left hand rule, the force on each current element will be radially outward. So, net force on the inner coil

F→1will be zero.

∴F1→=F2→=0Hence, the correct option is (1).

[[VIDEO:13834]]

Question 20:

Two long current carrying thin wires, both with current I, are held by insulating threads of length L and are in equilibrium as shown in the figure, with threads making an angle ‘θ‘ with the vertical. If wires have mass λ per unit length then the value of I is : (g = gravitational acceleration)

Option 1: sinθπλgLμ0cosθ
Option 2: 2sinθπλgLμ0cosθ
Option 3: 2πgLμ0tanθ
Option 4: 2πλgLμ0tanθ
Correct Answer: 2

 

Solutions:

Let l be the length of each long current carrying thin wire. Then, force on each wire due to other will be given by

F=μ02π.I2l2y                From figure, y=Lsinθ⇒F=μ0I2l4πLsinθFrom the equilibrium shown in figure, we have

Tsinθ=μ0I2l4πLsinθ andTcosθ =λgDividing both equations, we gettanθ=μ0I2l4πLsinθλlg⇒I2=4πLsin2θλgμ0cosθ⇒I=2sinθπλgLμ0cosθHence, the correct option is (2).

[[VIDEO:13835]]

Question 21:

A rectangular loop of sides 10 cm and 5 cm carrying a current I of 12 A is placed in different orientations as shown in the figures below:

If there is a uniform magnetic filed of 0.3 T in the positive z direction, in which orientations the loop would be in (i) stable equilibrium and (ii) unstable equilibrium?

Option 1: (a) and (b), respectively
Option 2: (a) and (c), respectively
Option 3: (b) and (d), respectively
Option 4: (b) and (c), respectively
Correct Answer: 3

 

Solutions:The torque on the current carrying loop in an external magnetic field is given by

τ=MBsinθwhere M is the magnetic moment of the loopB is the external magnetic fieldθ is the angle between themAlso, the potential energy of the field-magnet system is given by

U=-MBcosθFor figure (a),

θ=90°(b),

θ=0°(c),

θ=90°(d),

θ=180°(i) For stable equilibrium, torque on the loop should be zero and the potential energy of the field-magnet system should be minimum. This is possible for case (b), where

τ=MBsin0°=0 andU=-MBcos0°=-MBwhich is the minimum potential energy of the field-magnet system. Therefore, for case (b), orientation of the loop will be stable.

(ii) For unstable equilibrium, torque on the loop should be zero and the potential energy of the field-magnet system should be maximum. This is possible for case (d), where

τ=MBsin180°=0 andU=-MBcos180°=MBwhich is the maximum potential energy of the field-magnet system. Therefore, for case (d), orientation of the loop will be unstable.

Hence, the correct answer is option C.

Question 22:

An inductor (L = 0.03 H) and a resistor (R = 0.15 kΩ) are connected in series to a battery of 15 V EMF in a circuit shown below. The key K1 bas been kept closed for a long time. Then at t = 0, K1 is opened and key K2 is closed simultaneously. At t = 1 ms, the current in the circuit will be : (e5 ≌ 150)

Option 1: 100 mA
Option 2: 67 mA
Option 3: 6.7 mA
Option 4: 0.67 mA
Correct Answer: 4

 

Solutions:When key K1 closed for long time, the current through the inductor will be

I0=ER=150.15×103=0.1 ANow, K1 is opened and K2 is closed. So, the current through the circuit will be

i=I0e-t/τFor t=1 ms=1×10–3 s, time constant will beτ=LR=0.030.15×103=2×10-4tτ=1×10–32×10-4=5∴ i = 0.1e-5⇒i = 0.67 mAHence, the correct option is (4).

Question 23:

A red LED emits light at 0.1 watt uniformly around it. The amplitude of the electric field of the light at a distance of 1 m from the LED is

Option 1: 1.73 V/m
Option 2: 2.45 V/m
Option 3: 5.48 V/m
Option 4: 7.75 V/m
Correct Answer: 2

 

Solutions:Given: Power of the light source, P = 0.1 W Distance of the point from the light source, r = 1 m The intensity of light at a point at distance r from the source of light is given by,

I = P4πr2Let the average energy of the light be Uav.

Since, I=Uav×cand Uav=12∈0 E02⇒12∈0 E02c=P4πr2⇒E0=2P∈0 c×4πr2On substituting the values, ⇒E0=2.45 V m-1Hence, the correct answer is option B.

Question 24:

Monochromatic light is incident on a glass prism of angle A. If the refractive index of the material of the prism is µ, then a ray, incident at an angle θ on the face AB, would get transmitted through the face AC of the prism provided

Option 1: θ>sin-1μsinA-sin-11μ
Option 2: θ<sin-1μsinA-sin-11μ
Option 3: θ>cos-1μ sinA+sin-11μ
Option 4: θ<cos-1μ sinA+sin-11μ
Correct Answer: 1

 

Solutions:

sinθ=μsinr1⇒sinr1=sinθμ⇒r1=sin-1sinθμ   …..1μsinθc=1×sin 90°⇒sinθc=1μr2<θc⇒sinr2<sinθc⇒ r2<sin-11μr1+r2=A⇒r2=A-r1⇒r2=A-sin-1sinθμ    Using 1⇒A-sin-1sinθμ<sin-11μ⇒A-sin-11μ<sin-1sinθμ⇒sinA-sin-11μ<sinθμ⇒sin-1μsinA-sin-1μ<θHence, the correct answer is option A.

Question 25:

On a hot summer night, the refractive index of air is smallest near the ground and increases with height from the ground. When a light beam is directed horizontally, the Huygens’ principle leads us to conclude that as it travels, the light beam :

Option 1: becomes narrower
Option 2: goes horizontally without any deflection
Option 3: bends downwards
Option 4: bends upwards
Correct Answer: 4

 

Solutions:According to Huygens’ principle, each point on wavefront behaves as a point source of light. It is given here that the refractive index of air is smallest near the ground and increases with height from the ground. The speeds of the different parts of a plane wavefront, moving horizontally are different. The upper parts of the wavefront have lesser speeds than the lower parts. Also, as the refractive index increases with height, the plane wavefront does not remain horizontal as the rays will bend towards the normal. Thus, the beam of light directed horizontally will bend upwards.

Hence, the correct option is (4).

Question 26:

Assuming human pupil to have a radius of 0.25 cm and a comfortable viewing distance of 25 cm, the minimum separation between two objects that human eye can resolve at 500 nm wavelength is :

Option 1: 1 μm
Option 2: 30 μm
Option 3: 100 μm
Option 4: 300 μm
Correct Answer: 2

 

Solutions:Given: Radius of human pupil, r = 0.25 cm Wavelength of light, λ = 500 nm = 5 ✕ 10−7 m

Diameter of human pupil, d = 2r = 2 ✕ 0.25 = 0.5 cm

Let θ be the resolving angle for a naked eye. Then, sinθ=1.22λd∴ sinθ=1.22 × 5 ×10-75 ×10-3=1.22 ×10-4The distance of comfortable viewing, D = 25 cm = 0.25 m Let y be the minimum separation between two objects that the human eye can resolve.

∴ sinθ=yD      ⇒ x=Dsinθ=0.25 × 1.22 ×10-4= 3 × 10-5 m= 30 μmHence, the correct option is (2).

Question 27:

As an electron makes a transition from an excited state to the ground state of a hydrogen − like atom/ion :

Option 1: its kinetic energy increases but potential energy and total energy decrease
Option 2: kinetic energy, potential energy and total energy decrease
Option 3: kinetic energy decreases, potential energy increases but total energy remains same
Option 4: kinetic energy and total energy decrease but potential energy increases
Correct Answer: 1

 

Solutions:For an electron in a hydrogen-like atom/ion of atomic number Z.

The centripetal force is provided by the electrostatic force of attraction.

The kinetic energy of the electron is given by, K= 18πε0Ze2rThe potential energy of the electron is given by, P=-14πε0Ze2rThe total energy is given by, T=K+P=-18πε0Ze2rwhere r is the radius of the stationary state.

As, the electron makes a transition from an excited state to the ground state, the value of r decreases. Thus, the kinetic energy of the electron increases and potential energy and total energy decrease.

Hence, the correct option is (1).

Question 28:

Match List  − I (Fundamental Experiment) with List − II (its conclusion) and select the correct option from the choices given below the list :

List − I List − II
(A) Franck-Hertz Experiment. (i) Particle nature of light
(B) Photo-electric experiment. (ii) Discrete energy levels of atom
(C) Davison-Germer Experiment (iii) Wave nature of electron
(iv) Structure of atom
Option 1: A − (i), B − (iv), C − (iii)
Option 2: A − (ii), B − (iv), C − (iii)
Option 3: A − (ii), B − (i), C − (iii)
Option 4: A − (iv), B − (iii), C − (ii)
Correct Answer: 3

 

Solutions:Frank−Hertz experiment demonstrated the existence of excited states in mercury atoms. It confirmed that the electrons occupy only discrete, quantized energy states.

Photo−electric experiment proved the particle nature of light.

The Davisson-Germer experiment demonstrated the wave nature of the electron.

Hence, the correct option is (3).

Question 29:

A signal of 5 kHz frequency is amplitude modulated on a carrier wave of frequency 2 MHz. The frequencies of the resultant signal is/are :

Option 1: 2 MHz only
Option 2: 2005 kHz, and 1995 kHz
Option 3: 2005 kHz, 2000 kHz and 1995 kHz
Option 4: 2000 kHz and 1995 kHz
Correct Answer: 3

 

Solutions:Given frequency of carrier wave, fc =  2 MHz = 2000 kHz The frequency of modulated wave, fM = 5 kHz The frequencies of the resultant signal can be fcfM, fMfc + fM Therefore frequencies of the resultant signal can be 2005 Hz, 2000 Hz, 1995 Hz.

Hence, the correct option is (3).

Question 30:

An LCR circuit is equivalent to a damped pendulum. In an LCR circuit the capacitor is charged to Q0 and then connected to the L and R as shown below :

If a student plots graphs of the square of maximum charge

QMax2on the capacitor with time (t) for two different values L1 and L2 (L1 > L2) of L then which of the following represents this graph correctly? (plots are schematic and not drawn to scale)

Option 1:
Option 2:
Option 3:
Option 4:
Correct Answer: 1

 

Solutions:

(1)

Applying Kirchoff law to the close loop we get

qC-iR-LdidT=0But, i=-dqdt∴ qC+dqdtR+Ld2qdt2=0⇒d2qdt2+RLdqdt+qLC=0

As the generral solution of double differential equation d2xdt2+bmdxdt+kmx=0 isA=A0e-dt2m

So, the solution of above equation can be written asQmaxt=Q0e-Rt2L⇒Qmax2=Q02e-RtLThus, lesser the value of self induction, more the value of damping force. Therefore, the correct option is (1).

Question 31:

The molecular formula of a commercial resin used for exchanging ions in water softening is C8H7SO3Na (mol. wt. 206). What would be the maximum uptake of Ca2+ ions by the resin when expressed in mole per gram of resin?

Option 1: 1103
Option 2: 1206
Option 3: 2309
Option 4: 1412
Correct Answer: 4

 

Solutions:In synthetic resin method of water softening, Na+ ions are exchanged by Ca+ ions. This is given as 2 C8H7SO3Na(S)  +  Ca2+(aq)  

→(C8H7SO3)2Ca(s) + 2 Na+(aq) ResinMass of 1 mol of resin = 206 g Mass of 2 mol of resin = 412 g

412 g of resin uptakes 1 mol of Ca2+ ions 1 g of resin uptakes

1412mol of  Ca2+ ions Threrfore, the maximum uptake of Ca2+ ions by the resin when expressed in mole per gram is

1412. Hence, the correct answer is option D.

Question 32:

Sodium metal crystallizes in a body centred cubic lattice with a unit cell edge of 4.29 Å. The radius of sodium atom is approximately :

Option 1: 1.86 Å
Option 2: 3.22 Å
Option 3: 5.72 Å
Option 4: 0.93 Å
Correct Answer: 1

 

Solutions:Unit cell edge length (a) = 4.29

A∘Radius of sodium atom (r) = ?

For BCC lattice,

r =

34a

=

34 ×4.29

=  1.857

A∘             ~   1.86

A∘Hence, the correct option is (1).

Question 33:

Which of the following is the energy of a possible excited state of hydrogen?

Option 1: +13.6 eV
Option 2: −6.8 eV
Option 3: −3.4 eV
Option 4: +6.8 eV
Correct Answer: 3

 

Solutions:Energy of nth shell of hydrogen atom is given by

En =

-13.6n2eV For n = 2 E2

-13.622=

-3.4eV Therefore,

-3.4eV is the energy of a possible excited state of hydrogen.

Hence, the correct option is (3).

Question 34:

The intermolecular interaction that is dependent on the inverse cube of distance between the molecules is :

Option 1: ion−ion interaction
Option 2: ion−dipole interaction
Option 3: London force
Option 4: hydrogen bond
Correct Answer: 4

 

Solutions:Hydrogen bond is a special case of dipole-dipole interaction in which the intermolecular interaction is inversely proportional to the cube of distance between the molecules.

Hence, the correct option is (4).

Question 35:

The following reaction is performed at 298 K.

2NO(g) + O2(g) ⇌ 2NO2(g) The standard free energy of formation of NO(g) is 86.6 kJ/mol at 298 K. What is the standard free energy of formation of NO2(g) at 298 K? (Kp = 1.6 ✕ 1012)

Option 1: R(298) â„“n (1.6 ✕ 1012) −86600
Option 2: 86600 + R(298) ℓn (1.6 ✕ 1012)
Option 3: 86600 – ℓn (1.6 ×1012)R(298)
Option 4: 0.5 [2 ✕ 86,600 − R(298) â„“n (1.6 ✕ 1012)]
Correct Answer: 4

 

Solutions:For the reaction, 2NO(g) + O2(g) ⇌ 2NO2(g)

Kp = 1.6

×1012

 

∆GNO(g)°= 86.6 kJ/mol = 86600 J/mol

∆GReaction∘ = 2∆GNO2(g)°-2∆GNO(g)°

∆GNO2(g)°= 12∆GReaction° +2∆GNO(g)°                = 0.5-RT ln Kp+2×86600                  = 0.5-R298ln1.6×1012+2×86600Hence, the correct option is (4).

Question 36:

The vapour pressure of acetone at 20°C is 185 torr. When 1.2 g of a non − volatile substance was dissolved in 100 g of acetone at 20 °C, its vapour pressure was 183 torr. The molar mass (g mol−1)

Option 1: 32
Option 2: 64
Option 3: 128
Option 4: 488
Correct Answer: 2

 

Solutions:

Vapour pressure of pure acetoneP0 = 185 torrVapour pressure of solutionP = 183 torrAccording to Raoult law for non-volatile solute,Relative lowering in vapour pressure,               P0-PP0= n1n1+n2where n1 = moles of non-volatile solute          n2 = moles of solvent         185-183185=1.2M11.2M1+10058          M1= Molar mass of non-volatile solute                             M1= 64 g/molHence, the correct option is (B). [[VIDEO:13875]]

Question 37:

The standard Gibbs energy change at 300 K for the reaction 2A ⇌ B + C is 2494.2 J. At a given time, the composition of the reaction mixture is [A] =

12, [B] = 2 and [C] =

12. The reaction proceeds in the :

[R = 8.314 J/K/mol, e = 2.718]

Option 1: forward direction because Q > Kc
Option 2: reverse direction because Q > Kc
Option 3: forward direction because Q < Kc
Option 4: reverse direction because Q < Kc
Correct Answer: 2

 

Solutions:

∆G°=-RT 1ne Kc                                   2494.2=8.314 ×300 1ne Kc                       Kc=e-1                                              Kc= 1e= 12.718 = 0.36                  for reaction below,  2A ⇌ B + C  reaction quotient Q=BCA2                                     Q= 2×12122=4As reaction quotientQ is greater than KC , it means reaction proceed in reverse direction.Hence, the correct option is 2.

Question 38:

Two Faraday of electricity is passed through a solution of CuSO4. The mass of copper deposited at the cathode is : (at. mass of Cu = 63.5 amu)

Option 1: 0 g
Option 2: 63.5 g
Option 3: 2 g
Option 4: 127 g
Correct Answer: 2

 

Solutions:

According to Faraday law of electrolysis, Mass depositM = EF×QE= Atomic mass nFor Cu2+, n=2 and atomic mass =63.5 amuCharge Q=2×F       M=63.52×F×2×F        M= 63.5 gHence, the correct option is (2).

Question 39:

Higher order (>3) reactions are rare due to :

Option 1: low probability of simultaneous collision of all the reacting species
Option 2: increase in entropy and activation energy as more molecules are involved
Option 3: shifting of equilibrium towards reactants due to elastic collisions
Option 4: loss of active species on collision
Correct Answer: 1

 

Solutions:Probability of simultaneous collision decreases exponentially as order increases. For order greater than 3, probability of simultaneous collision is low for all the reacting species.

Hence, the correct option is (1).

Question 40:

3 g of activated charcoal was added to 50 mL of acetic acid solution (0.06 N) in a flask. After an hour it was filtered and the strength of the filtrate was found to be 0.042 N. The amount of acetic acid adsorbed (per gram of charcoal) is :

Option 1: 18 mg
Option 2: 36 mg
Option 3: 42 mg
Option 4: 54 mg
Correct Answer: 1

 

Solutions:

Initial no. of moles of acetic acid =50×10-3 ×0.06 =3×10-3After adsoption no. of moles of acetic acid  =50×10-3×0.042=2.1×10-3 Molar mass of acetic acid=60 g/mol Mass of acetic acid adsored=3-2.1×10-3×60=54×10-3 g Thus 3g of charcoal adsorbe 54×10-3 g of acetic acid , 1g of charcoal adsorbe 54×10-33 g of acetic acid. Mass of acetic acid= 18×10-3g=18 mg.Hence, the correct option is (1).

Question 41:

The ionic radii (in Å) of N3−, O2− and F are respectively :

Option 1: 1.36, 1.40 and 1.71
Option 2: 1.36, 1.71 and 1.40
Option 3: 1.71, 1.40 and 1.36
Option 4: 1.71, 1.36 and 1.40
Correct Answer: 3

 

Solutions:

As charge on anion increases, its ionic radii also increases. N3- has more charge than O2- and F-, so it have larger ionic radii order areN3- > O2- > F-Hence, the correct option is (3).

Question 42:

In the context of the Hall−Heroult process for the extraction of Aâ„“, which of the following statements is false?

Option 1: CO and CO2 are produced in this process
Option 2: Aâ„“2O3 is mixed with CaF2 which lowers the melting point of the mixture and brings conductivity.
Option 3: Aâ„“3+ is reduced at the cathode to form Aâ„“.
Option 4: Na3Aâ„“F6 serves as the electrolyte.
Correct Answer: 4

 

Solutions:In the the Hall−Heroult process for the extraction of aluminium, Na3AlF6 added to reduced the melting point alumina (Al2O3).

Hence, the correct option is (4).

Question 43:

From the following statements regarding H2O2, choose the incorrect statement :

Option 1: It can act only as an oxidizing agent
Option 2: It decomposes on exposure to light
Option 3: It has to be stored in plastic or wax lined glass bottles in dark
Option 4: It has to be kept away from dust
Correct Answer: 1

 

Solutions:H2O2 can acts as both oxidizing as well as reducing agent.

Hence, the correct option is (1).

Question 44:

Which one of the following alkaline earth metal sulphates has its hydration enthalpy greater than its lattice enthalpy?

Option 1: CaSO4
Option 2: BeSO4
Option 3: BaSO4
Option 4: SrSO4
Correct Answer: 2

 

Solutions:For solubility, Hydration enthalpy > Lattice enthalpy BeSO4 is most soluble among the all alkali earth metal sulphate due to its small size. So, BeSO4 has greater hydration enthalpy than its lattice enthalpy.

Hence, the correct option is (2).

Question 45:

Which among the following is the most reactive?

Option 1: Cl2
Option 2: HF
Option 3: I2
Option 4: ICI
Correct Answer: 4

 

Solutions:Among the given compounds, ICl is more reactive. Because intra halogen bond is stronger than inter halogen bond. Therefore, interhalogen compound (ICl) is more reactive than intrahalogen compounds (except F2). In HF, intermolecular hydrogen bonding is present. So, it is less reactive.

Hence, the correct answer is option D.

Question 46:

Match the catalysts to the correct processes:

Catalyst Process
(A) TiCl3 (i) Wacker process
(B) PdCl2 (ii) Ziegler − Natta polymerization
(C) CuCl2 (iii) Contact process
(D) V2O5 (iv) Deacon’s process
Option 1: (A) − (iii), (B) − (ii), (C) − (iv), (D) − (i)
Option 2: (A) − (ii), (B) − (i), (C) − (iv), (D) − (iii)
Option 3: (A) − (ii), (B) − (iii), (C) − (iv), (D) − (i)
Option 4: (A) − (iii), (B) − (i), (C) − (ii), (D) − (iv)
Correct Answer: 2

 

Solutions:

Catalyst Process
(A) TiCl3 (ii) Ziegler − Natta polymerization
(B) PdCl2 (i) Wacker process
(C) CuCl2 (iv) Deacon’s process
(D) V2O5 (iii) Contact process

Hence, the correct option is (2).

Question 47:

Which one has the highest boiling point?

Option 1: He
Option 2: Ne
Option 3: Kr
Option 4: Xe
Correct Answer: 4

 

Solutions:Noble gas molecules have van der Waals interactions between their atoms. Greater the molecular mass, stronger will be the van der Waals forces between the atoms and higher will be the boiling point. Thus, Xe has the highest boiling point.

Hence, the correct option is (4). [[VIDEO:13876]]

Question 48:

The number of geometric isomers that can exist for square planar [Pt (Cl) (py) (NH3) (NH2OH)]+ is (py = pyridine) :

Option 1: 2
Option 2: 3
Option 3: 4
Option 4: 6
Correct Answer: 2

 

Solutions:[Pt(Cl) (py) (NH3) (NH2OH)]+ exists in three geometrical isomers.

Hence, the correct option is (2). [[VIDEO:13877]]

Question 49:

The color of KMnO4 is due to:

Option 1: M → L charge transfer transition
Option 2: d → d transition
Option 3: L → M charge transfer transition
Option 4: σ − σ* transition
Correct Answer: 3

 

Solutions:In KMnO4, Mn has +7 oxidation state, that means it has no d-electrons. Thus the colour of KMnO4 is not due to d-d transition. The colour of KMnO4 is due to ligand to metal charge transfer transition.

Hence, the correct option is (3).

Question 50:

Assertion : Nitrogen and Oxygen are the main components in the atmosphere but these do not react to form oxides of nitrogen. Reason : The reaction between nitrogen and oxygen requires high temperature.

Option 1: Both assertion and reason are correct, and the reason is the correct explanation for the assertion
Option 2: Both assertion and reason are correct, but the reason is not the correct explanation for the assertion
Option 3: The assertion is incorrect, but the reason in correct
Option 4: Both the assertion and reason are incorrect
Correct Answer: 1

 

Solutions:Nitrogen and Oxygen are the main components in the atmosphere but these do not react to form oxides of nitrogen as the reaction requires high temperature. Thus both the assertion and reason are correct.

Hence, the correct option is (1). [[VIDEO:13879]]

Question 51:

In Carius method of estimation of halogens, 250 mg of an organic compound gave 141 mg of AgBr. The percentage of bromine in the compound is : (at. mass Ag = 108; Br = 80)

Option 1: 24
Option 2: 36
Option 3: 48
Option 4: 60
Correct Answer: 1

 

Solutions:Mass of organic compound = 250 mg = 0.25 g Mass of AgBr = 141 mg = 0.141 g Molar mass of AgBr = 108 + 80 = 188 g/mol 188 g AgBr contains 80 g bromine 0.141 g AgBr contains

80188×0.141 gbromine.

Percentage of bromine=80×0.141×100188×0.25=24Hence, the correct option is (1).

Question 52:

Which of the following compounds will exhibit geometrical isomerism?

Option 1: 1−Phenyl−2−butene
Option 2: 3−Phenyl−1−butene
Option 3: 2−Phenyl−1−butene
Option 4: 1,1−Diphenyl−1−propane
Correct Answer: 1

 

Solutions:Of the given organic compounds, 1−Phenyl−2−butene shows the geometrical isomerism

Hence, the correct option is (1). [[VIDEO:13880]]

Question 53:

Which compound would give 5−keto−2−methyl hexanal upon ozonolysis?

Option 1:
Option 2:
Option 3:
Option 4:
Correct Answer: 2

 

Solutions:

Hence, the correct option is (2). [[VIDEO:13881]]

Question 54:

The synthesis of alkyl fluorides is best accomplished by :

Option 1: Free radical fluorination
Option 2: Sandmeyer’s reaction
Option 3: Finkelstein reaction
Option 4: Swarts reaction
Correct Answer: 4

 

Solutions:The synthesis of alkyl fluorides is best accomplished by Swarts reaction.

Hence, the correct option is (4).

Question 55:

In the following sequence of reactions :

Toluene →KMnO4 A →SOCl2 B →BaSO4H2/Pd C, the product C is :

Option 1: C6H5COOH
Option 2: C6H5CH3
Option 3: C6H5CH2OH
Option 4: C6H5CHO
Correct Answer: 4

 

Solutions:

Hence, the correct option is (4). [[VIDEO:13882]]

Question 56:

In the reaction

Option 1:
Option 2:
Option 3:
Option 4:
Correct Answer: 3

 

Solutions:

Hence, the correct option is (3).

Question 57:

Which polymer is used in the manufacture of paints and lacquers?

Option 1: Bakelite
Option 2: Glyptal
Option 3: Polypropene
Option 4: Poly vinyl chloride
Correct Answer: 2

 

Solutions:Glyptal is used in the manufacture of paints and lacquers.

Hence, the correct option is (2).

Question 58:

Which of the vitamins given below is water soluble?

Option 1: Vitamin C
Option 2: Vitamin D
Option 3: Vitamin E
Option 4: Vitamin K
Correct Answer: 1

 

Solutions:Out of given vitamins, only vitamin C is water soluble.

Hence, the correct option is (1).

Question 59:

Which of the following compounds is not an antacid?

Option 1: Aluminium hydroxide
Option 2: Cimetidine
Option 3: Phenelzine
Option 4: Ranitidine
Correct Answer: 3

 

Solutions:Phenelzine is an antidepressant drug. It is not an antacid.

Hence, the correct option is (3). [[VIDEO:13884]]

Question 60:

Which of the following compounds is not colored yellow?

Option 1: Zn2[Fe(CN)6]
Option 2: K3[Co(NO2)6]
Option 3: (NH4)3 [As (Mo3 O10)4]
Option 4: BaCrO4
Correct Answer: 1

 

Solutions:Zn2 [Fe(CN)6] is bluish white ppt.

Hence, the correct option is (1). [[VIDEO:13885]]

Question 61:

Let A and B be two sets containing four and two elements respectively. Then the number of subsets of the set A ✕ B, each having at least three elements is :

Option 1: 219
Option 2: 256
Option 3: 275
Option 4: 510
Correct Answer: 1

 

Solutions:Number of elements in set A = 4 Number of elements in set B = 2 ∴ Number of elements in set A × B = 4 × 2 = 8 ⇒ Total number of subsets of A × B = 28 = 256 Now, Number of subsets of A × B having 0 elements =

C08=1Number of subsets of A × B having 1 element =

C18=8Number of subsets of A × B having 2 elements

=C28=8!2! 6!=8×72=28∴ Number of subsets having at least 3 elements = Total number of subsets of A × B − Number of subsets of A × B having 0 elements − Number of subsets of A × B having 1 element − Number of subsets of A × B having 2 elements = 256 − 1 − 8 − 28 = 256 − 37 = 219

Hence, the correct option is (1).

Question 62:

A complex number z is said to be unimodular if

z=1. Suppose z1 and z2 are complex numbers such that

z1-2z22-z1z2is unimodular and z2 is not unimodular. Then the point z1 lies on a :

Option 1: straight line parallel to x-axis
Option 2: straight line parallel to y-axis
Option 3: circle of radius 2
Option 4: circle of radius

2

Correct Answer: 3

 

Solutions:Since,

z1-2z22-z1z2is unimodular.

∴z1-2z22-z1z2=1⇒z1-2z22=2-z1z22⇒z1-2z2 z1-2z2=2-z1z2 2-z1z2                 ∵zz=z2⇒z1-2z2 z1-2z2=2-z1z2 2-z1z2

⇒z1z1-2z1z2-2z2z1+4z2z2=4-2z1z2-2z1z2+z1z1z2z2⇒z1z1+4z2z2=4+z1z1z2z2⇒4+z12 z22-4 z22-z12=0                  ∵zz=z2⇒z22-1z22-4=0But, z2≠1                    ∵z2 is not unimodular∴z2=2This represents a circle with centre (0, 0) and radius 2 units.

Hence, the correct option is (3).

Question 63:

Let α and β be the roots of equation x2 − 6x − 2 = 0. If an = αn − βn, for n ≥ 1, then the value of

a10-2a82a9is equal to :

Option 1: 6
Option 2: −6
Option 3: 3
Option 4: −3
Correct Answer: 3

 

Solutions:The given equation is

x2-6x-2=0.

Multiplying the given equation by

x8, we get

x10-6×9-2×8=0Since α and β are the roots of the given equation, so

α10-6α9-2α8=0               …..1β10-6β9-2β8=0               …..2Subtracting (2) from (1), we get

α10-β10-6α9-β9-2α8-β8=0⇒a10-6a9-2a8=0                            an=αn-βn⇒a10-2a82a9=3Hence, the correct option is (3).

Question 64:

If

A=12221-2a2bis a matrix satisfying the equation AAT = 9I, where I is 3 ✕ 3 identity matrix, then the ordered pair (a, b) is equal to:

Option 1: (2, −1)
Option 2: (−2, 1)
Option 3: (2, 1)
Option 4: (−2, −1)
Correct Answer: 4

 

Solutions:We have,

AAT=9I⇒12221-2a2b 12a2122-2b=9I⇒90a+4+2b092a+2-2ba+4+2b2a+2-2ba2+4+b2=900090009So,

a+4+2b=0⇒a+2b=-4     …..12a+2-2b=0⇒2a-2b=-2     …..2a2+4+b2=0⇒a2+b2=5     …..3Solving 1, 2 and 3, we geta=-2, b=-1Hence, the correct option is (4).

Question 65:

The set of all values of λ for which the system of linear equations : 2x1 − 2x2 + x3 = λx1 2x1 − 3x2 + 2x3 = λx2x1 + 2x2 = λx3 has a non-trivial solution,

Option 1: is an empty set
Option 2: is a singleton
Option 3: contains two elements
Option 4: contains more than two elements
Correct Answer: 3

 

Solutions:The given system of equations can be rewritten as

(2 − λ)x1 − 2x2 + x3 = 0 2x1 − (3 + λ)x2 + 2x3 = 0 −x1 + 2x2λx3 = 0

Now, this system of equations has a non-trivial solution if

∆=2-λ-212-3-λ2-12-λ=0⇒ (2 − λ)(3λ + λ2 − 4) + 2(−2λ + 2) + (4 − 3 − λ) = 0                (Expanding along R1) ⇒ 6λ + 2λ2 − 8 − 3λ2λ3 + 4λ − 4λ + 4 + 1 − λ = 0 ⇒ λ3 + λ2 − 5λ + 3 = 0 ⇒ λ3λ2 + 2λ2 − 2λ − 3λ + 3 = 0 ⇒ λ2 (λ − 1) + 2λ(λ − 1) − 3(λ − 1) = 0 ⇒ (λ − 1) (λ2 + 2λ − 3) = 0 ⇒ (λ − 1) (λ + 3) (λ − 1) = 0 ⇒ λ = 1, 1, −3

Thus, the set of all values of λ for which the system of linear equations has a non-trival solution contains two elements.

Hence, the correct option is (3).

Question 66:

The number of integers greater than 6,000 that can be formed, using the digits 3, 5, 6, 7 and 8, without repetition, is:

Option 1: 216
Option 2: 192
Option 3: 120
Option 4: 72
Correct Answer: 2

 

Solutions:Case I: We know All 5-digit numbers are greater than 6,000.

∴ Total numbers greater than 6,000 formed using 5 digits = 5! = 120

Case II: Using 4 digits

6,7 or 84 ways3 ways2 waysi.e. 3 ways∴ Total numbers greater than 6,000 formed using 4 digits = 3 × 4 × 3 × 2 = 72

Total number greater than 6,000 formed using the given digits = 120 + 72 = 192

Hence, the correct option is (2). [[VIDEO:13752]]

Question 67:

The sum of coefficient of integral power of x in the binomial expansion of

1-2x50is :

Option 1: 12350+1
Option 2: 12350
Option 3: 12350-1
Option 4: 12250+1
Correct Answer: 1

 

Solutions:

1-2×50=50C0-50C12x1+50C22x2-50C32x3+50C42x4- …-50C492x49 +50C502x50Sum of coefficients of integral powers of x in the above expansion,

S=50C0+50C2·22+50C4·24+…+50C50.250Now, 1+x50=50C0+50C1 x+50C2 x2+50C3 x3+50C4 x4+…+50C50 x50           …..1Putting x = 2 and x = −2 in (1), we get

350=50C0+50C1·2+50C2·22+50C3·23+50C4·24+…+50C50·220             …..21=50C0-50C1·2+50C2·22-50C3·23+50C4·24-…+50C50·250                …..3Adding (2) and (3), we get

350+1=250C0+50C2.22+50C4.24+…+50C50·250⇒50C0+50C2·22+50C4·24+…+50C50·250=350+12Thus, the sum of the coefficients of integral powers of x in the given binomial expansion is

12350+1.

Hence, the correct option is (1). [[VIDEO:13753]]

Question 68:

If m is the A.M. of two distinct real numbers â„“ and n (â„“, n > 1) and G1, G2 and G3 are three geometric means between â„“ and n, then

G14+2G24+G34equals,

Option 1: 4â„“2 mn
Option 2: 4â„“m2n
Option 3: 4â„“mn2
Option 4: 4â„“2m2n2
Correct Answer: 2

 

Solutions: It is given that m is the A.M. of â„“ and n.

⇒ 2m = â„“ + n              …..(1)

Also, â„“, G1, G2, G3, n are in G.P.

Let r be the common ratio of G.P.

∴ G1 = â„“r, G2 = â„“r2, G3 = â„“r3, n = â„“r4

n=ℓr4  ⇒r4=nℓ ∴ G14+2G24+G34=ℓ4r4 1+2r4+r8                         =ℓ4.nℓ 1+2nℓ+nℓ2                         =nℓ31+nℓ2                         =nℓ3n+ℓ2ℓ2                         =nℓ2m2                         =4ℓm2nHence, the correct option is (2). [[VIDEO:13754]]

Question 69:

The sum of first 9 terms of the series

131+13+231+3+13+23+331+3+5+…is

Option 1: 71
Option 2: 96
Option 3: 142
Option 4: 192
Correct Answer: 2

 

Solutions:nth term of the given series,

an=13+23+…+n31+3+5+…+2n-1

=nn+122n21+2n-1                        Sn=n2a+l=n2n+124n2=n+124 ∴∑n=19 an=14∑n=19 n+12=1422+32+…+102=1412+22+…+102-1=141010+12×10+16-1                12+22+32+…+n2=nn+12n+16=96Thus, the sum of first nine terms of the series is 96.

Hence, the correct option is (2). [[VIDEO:13755]]

Question 70:

limx→0 1-cos2x 3+cosxxtan4xis equal to :

Option 1: 4
Option 2: 3
Option 3: 2
Option 4: 12
Correct Answer: 3

 

Solutions:

limx→0 1-cos2x3+cosxxtan 4x=limx→0 2 sin2x3+cosxxtan4x=limx→02sin2xx23+cosx4xtan4x4x2=2limx→0sinxx23+limx→0cosx4limx→0tan4x4x=2×12×3+14×1=2Hence, the correct option is (3).

Question 71:

If the function,

gx=kx+1 , 0 ≤ x ≤ 3mx+2    , 3 < x ≤ 5is differentiable, then the value of k + m is:

Option 1: 2
Option 2: 165
Option 3: 103
Option 4: 4
Correct Answer: 1

 

Solutions:We have,

gx=kx+1,  0≤x≤3mx+2,     3<x≤5It is given that g(x) is differentiable function.

g(x) is continuous function.

⇒limx→3-gx=limx→3+gx=g3⇒limx→3-kx+1=limx→3+mx+2=g3⇒2k=3m+2=2k       …..1Also,

g’x=k2x+1,  0≤x≤3   m,            3<x≤5  L.H.D at x=3=limx→3-g’x=k4R.H.D at x=3=limx→3+g’x=mSince g(x) is differentiable function.

∴ L.H.D=R.H.D.⇒k4=m                …..2From 1 and 2, we getm=25, k=85∴ k+m=2Hence, the correct option is (1).

Question 72:

The normal to the curve, x2 + 2xy − 3y2 = 0, at (1, 1) :

Option 1: does not meet the curve again
Option 2: meets the curve again in the second quadrant
Option 3: meets the curve again in the third quadrant
Option 4: meets the curve again in the fourth quadrant
Correct Answer: 4

 

Solutions:Given:

x2 + 2xy − 3y2 = 0         …..(1)

Differentiating on both sides with respect to x, we get

2x+2xdydx+y-6ydydx=0⇒x+xdydx+y-3ydydx=0⇒x-3ydydx=-x+y⇒dydx=-x+yx-3y⇒dydx1,1 =1∴ Slope of the normal at (1, 1) =

-1dydx1, 1−1

Now, the equation of normal to the curve at (1, 1) is

y − 1 = −1(x − 1)

x + y = 2                …..(2)

Solving (1) and (2), we get

x2 + 2x (2 − x) −3 (2 − x)2 = 0 ⇒ x2 + 4x − 2x2 − 3 (4 + x2 − 4x) = 0 ⇒ x2 + 4x − 2x2 − 12 − 3x2 + 12x = 0 ⇒ −4x2 + 16x − 12 = 0 ⇒ x2 − 4x + 3 = 0 ⇒ (x − 1)(x − 3) = 0 ⇒ x = 1, 3

From (2), we have

When x = 1, y = 1 x = 3, y = −1

So, the point of intersection of normal and the curve are (1, 1) and (3, −1).

Thus, the normal meets the curve again at (3, −1). This point lies in the fourth quadrant.

Hence, the correct option is (4).

Question 73:

Let f(x) be a polynomial of degree four having extreme values at x = 1 and x = 2. If

limx→01+fxx2=3,then f(2) is equal to:

Option 1: − 8
Option 2: − 4
Option 4: 4
Correct Answer: 3

 

Solutions:We have

limx→01+fxx2=3⇒limx→0fxx2=2 ∴ fxx2=ax2+bx+2, where a, b∈R and a≠0⇒fx=ax4+bx3+2×2⇒f’x=4ax3+3bx2+4xNow, f’1=4a+3b+4=0              …..1and f’2=32a+12b+8=0⇒8a+3b+2=0                    …..2Solving 1 and 2, we geta=12, b=-2∴ fx=x42-2×3+2x2So, f2=8-16+8=0Hence, the correct option is (3). [[VIDEO:13756]]

Question 74:

The integral

∫dxx2x4+13/4equals :

Option 1: x4+1×414+c
Option 2: x4+114+c
Option 3: -x4+114+c
Option 4: -x4+1×414+c
Correct Answer: 4

 

Solutions:

I=∫dxx2x4+134=∫dxx2·x31+1×434=∫dxx51+1×434 Let 1+1×4=t⇒-4x5dx=dt ∴ I=-14∫dtt34=-14t-34+1-34+1+C=-14t1414+C=-1+1×414+C=-x4+1×414+CHence, the correct option is (4).

Question 75:

The integral

∫24log x2log x2+log36-12x+x2dx is equal to :

Option 1: 2
Option 2: 4
Option 3: 1
Option 4: 6
Correct Answer: 3

 

Solutions:

I=∫24log x2log x2+log36-12x+x2dx⇒I=∫24log x2log x2+log6-x2dx⇒I=∫24log xlog x+log6-xdx               …..1                  logab=bloga ⇒I=∫24log6-xlog6-x+log xdx          …..2            ∫abfxdx=∫abfa+b-xdxAdding (1) and (2), we get

2I=∫24log x+log 6-xlog6-x+log xdx⇒2I=∫241dx⇒2I=x24⇒2I=4-2=2⇒I=1Hence, the correct option is (3).

Question 76:

The area (in sq. units) of the region described by {(x, y) : y2 ≤ 2x and y ≥ 4x − 1} is :

Option 1: 732
Option 2: 564
Option 3: 1564
Option 4: 932
Correct Answer: 4

 

Solutions:We have

y2 ≤ 2x and y ≥ 4x − 1

The region enclosed by the given curves is the shaded region.

Solving y2 = 2x and y = 4x − 1, we get

y = 1,

-12

∴ Required area=∫-121y+14-y22dy=y28+y4-y36-121=18+14-16-132-18+148=932 square unitsHence, the correct option is (4). [[VIDEO:13757]]

Question 77:

Let y(x) be the solution of the differential equation

xlogxdydx+y=2xlogx, x≥1.Then y(e) is equal to :

Option 1: e
Option 3: 2
Option 4: 2e
Correct Answer: 3

 

Solutions:Given:

xlogxdydx+y=2xlogx,  x≥1              …..1 ⇒dydx+yxlogx=2This is a linear differential equation.

Its integrating factor is given by

I.F.=e∫1xlogxdx=eloglogx=logxHence, the solution of the given differential equation is

y·log x=∫2log x dx+C⇒y·logx=2xlog x-x +C⇒y·logx=2xlogx-1 +CNow, when x = 1, y = 0         [Using (1)] ∴0=2×1× 0-1+C⇒C=2 ∴ y·lnx=2xlogx-1+2     …..2Putting x = e in (2), we get

yloge=2eloge-1+2⇒y×1=2e1-1+2⇒y=2Hence, the correct option is (3).

Question 78:

The number of points, having both co-ordinates as integers, that lie in the interior of the triangle with vertices (0, 0), (0, 41) and (41, 0), is:

Option 1: 901
Option 2: 861
Option 3: 820
Option 4: 780
Correct Answer: 4

 

Solutions:The equation of line AB is given by y − 0 =

41-00-41(x − 41) ⇒ y − 0 = (−1)(x − 41) ⇒ x + y = 41

For y = 1, The abscissa of the required points are 1, 2, 3, …, 39. So, the number of required points for y = 1 is 39.

Similarly, Number of required points for y = 2 is 38.

. . .

And, Number of required points for y = 39 is 1.

∴ Total number of required points

= 39+38+37+ … +1 =3939+12=780Hence, the correct option is (4). [[VIDEO:13758]]

Question 79:

Locus of the image of the point (2, 3) in the line (2x − 3y + 4) + k(x − 2y + 3) = 0, k

R, is a :

Option 1: straight line parallel to x-axis.
Option 2: straight line parallel to y-axis.
Option 3: circle of radius

2.

Option 4: circle of radius

3.

Correct Answer: 3

 

Solutions:The equation of the given line is (2x − 3y + 4) + k(x − 2y + 3) = 0.

This represents a family of straight lines passing through the point (1, 2).

Let (α, β) be the image of the point (2, 3) in the given line.

Now, ∆BAD

≅∆BCD     (By SAS congruence criterion)

∴ BC = AB      (CPCT)

⇒α-12+β-22=2-12+3-22=2⇒α-12+β-22=22Thus, the locus of image of the point (2, 3) in the given line is

x-12+y-22=22This represents a circle of radius

2.

Hence, the correct option is (3).

Question 80:

The number of common tangents to the circles x2 + y2 − 4x − 6y − 12 = 0 and x2 + y2 + 6x + 18y + 26 = 0, is:

Option 1: 1
Option 2: 2
Option 3: 3
Option 4: 4
Correct Answer: 3

 

Solutions:We have

x2+y2-4x-6y-12=0⇒x-22+y-32=25∴ C1=2, 3 and r1=5And,x2+y2+6x+18y+26=0⇒x+32+y+92=64∴ C2=-3, -9 and r2=8So, dC1, C2=52+122=13Also, r1+r2=8+5=13∵ dC1, C2=r1+r2So, the circles touch each other externally. Therefore, the number of common tangents to the given circles is 3.

Hence, the correct option is (3). [[VIDEO:13759]]

Question 81:

The area (in sq. units) of the quadrilateral formed by the tangents at the end points of the latera recta to the ellipse

x29+y25=1,is :

Option 1: 274
Option 2: 18
Option 3: 272
Option 4: 27
Correct Answer: 4

 

Solutions:

The equation of the ellipse is

x29+y25=1.

Here,

a=3 and b=5Now,

b2=a21-e2⇒5=91-e2⇒e2=1-59=49⇒e=23Foci of the ellipse =

±ae, 0=±3×23, 0=±2, 0Also,

b2a=53So, one end point of the latus rectum =

2, 53∴ Equation of the tangent to the ellipse at

2, 53is

2×9+53y5=1                        xx1a2+yy1b2=1⇒x92+y3=1This intersects the x-axis and y-axis at A

92, 0and B(0, 3), respectively.

The quadrilateral formed by the tangents at the end points of the latera racta of the given ellipse is a rhombus.

∴ Area of the rhombus formed by tangents

= 4 × Area of ∆AOB

=4×12×OA×OB=4×12×92×3= 27 square units Thus, the area of the quadrilateral formed by the tangents at the end points of the latera recta to the given ellipse is 27 square units.

Hence, the correct option is (4). [[VIDEO:13760]]

Question 82:

Let O be the vertex and Q be any point on the parabola, x2 = 8y. If the point P divides the line segment OQ internally in the ratio 1 : 3, then the locus of P is:

Option 1: x2 = y
Option 2: y2 = x
Option 3: y2 = 2x
Option 4: x2 = 2y
Correct Answer: 4

 

Solutions:Let any point on the parabola x2 = 8y be Q(4t, 2t2). Let the coordinates of the point P be (x, y).

Since, P divides OQ internally in the ratio 1 : 3,

∴ x,y=14t+301+3,12t2+301+3 ⇒x,y=t,t22∴ x=t, y=t22⇒2y=x2Hence, the correct option is (4). [[VIDEO:13761]]

Question 83:

The distance of the point (1, 0, 2) from the point of intersection of the line

x-23=y+14=z-212and the plane xy + z = 16, is:

Option 1: 214
Option 2: 8
Option 3: 321
Option 4: 13
Correct Answer: 4

 

Solutions:

Let

x-23=y+14=z-212=λ∴ x = 3

λ+ 2, y = 4

λ– 1 and z = 12

λ+ 2

So, the coordinates of any point on the line is (3

λ+ 2, 4

λ– 1, 12

λ+ 2). Also, this point lies on the plane xy + z = 16.

∴ (3

λ+ 2) – (4

λ– 1) + (12

λ+ 2) = 16

⇒ 3

λ+ 2 – 4

λ+ 1 + 12

λ+ 2 = 16

λ= 1

∴ (x, y, z) = (5, 3, 14)

Required distance between the points (1, 0, 2) and (5, 3, 14)

=5-12+3-02+14-22=42+32+122=13 unitsHence, the correct option is (4). [[VIDEO:13762]]

Question 84:

The equation of the plane containing the line 2x – 5y + z = 3; x + y + 4z = 5, and parallel to the plane, x + 3y + 6z = 1, is :

Option 1: 2x + 6y + 12z = 13
Option 2: x + 3y + 6z = –7
Option 3: x + 3y + 6z = 7
Option 4: 2x + 6y + 12z = –13
Correct Answer: 3

 

Solutions:Putting z = 0 in first two planes, we get

∴ 2x – 5y = 3 and x + y = 5

x = 4, y = 1, when z = 0

⇒ (4, 1, 0) lies on the given plane.

Let x + 3y + 6z = k be a plane parallel to given plane x + 3y + 6z =1.

∴ 4 + 3 + 0 = k

k = 7

x + 3y + 6z = 7, which is the equation of the required plane

Hence, the correct option is (3). [[VIDEO:13763]]

Question 85:

Let

a→,

b→and

c→be three non-zero vectors such that no two of them are collinear and

a→×b→×c→=13b→c→a→.If θ is the angle between vectors

b→and

c→then a value of sin θ is:

Option 1: 223
Option 2: -23
Option 3: 23
Option 4: -233
Correct Answer: 1

 

Solutions:

a→×b→×c→=13b→c→a→⇒-c→×a→×b→=13b→c→a→⇒-c→·b→a→-c→·a→b→=13b→c→a→⇒c→·a→b→-c→·b→a→=13b→c→a→Equating the components of

a→, we get

-c→·b→=13b→c→⇒-c→b→cosθ=13b→c→⇒cosθ=-13∴ sinθ=1-cos2θ=1–132=223Hence, the correct option is (1). [[VIDEO:13764]]

Question 86:

If 12 identical balls are to be placed in 3 identical boxes, then the probability that one of the boxes contains exactly 3 balls is :

Option 1: 553 2311
Option 2: 552310
Option 3: 2201312
Option 4: 221311
Correct Answer: 1

 

Solutions:Disclaimer: There seems to be ambiguity in the given question. Instead of identical balls, 12 different balls should be used to find the required probability.

Total number of ways in which 12 balls can be placed in 3 identical boxes = 312

Now, Number of ways of selecting 3 balls out of 12 =

C312=220

So, number of ways of placing these 3 selected balls in one box = 220

Number of ways of ways in which 9 remaining balls can be placed in 2 identical boxes = 29

∴ Favourable number of ways = 220 × 29

Probability that one of the boxes contains exactly 3 balls

=Favourable number of waysTotal number of ways=220×29312=2204×3×211311=5532311Hence, the correct option is (1).

Question 87:

The mean of the data set comprising of 16 observations is 16. If one of the observation valued 16 is deleted and three new observations valued 3, 4 and 5 are added to the data, then the mean of the resultant data, is :

Option 1: 16.8
Option 2: 16.0
Option 3: 15.8
Option 4: 14.0
Correct Answer: 4

 

Solutions:It is given that the mean of 16 observations is 16.

⇒∑xi16=16⇒∑xi=256Now, from the given 16 observations, one observation is deleted and three other are added. So, the total number of observations become 16

-1 + 3 i.e. 18.

Mean of the resultant data

=∑xi-16+3+4+518=256-16+3+4+518=25218=14Hence, the correct option is (4).

Question 88:

If the angles of elevation of the top of a tower from three collinear points A, B and C, on a line leading to the foot of the tower, are 30°, 45° and 60° respectively, then the ratio AB : BC is :

Option 1: 3:1
Option 2: 3:2
Option 3: 1 :3
Option 4: 2 : 3
Correct Answer: 1

 

Solutions:Let P be the top of the tower.

Suppose the height of the tower PQ is h units.

In

∆PAQ ,

PQAQ=tan30° ⇒hAQ=13⇒AQ=3hIn

∆PBQ,

PQBQ=tan45°=1 BQ=PQ=hAlso, in

∆PCQ,

PQCQ=tan60°⇒hCQ=3⇒CQ=h3 ∴ ABBC=AQ-BQBQ-CQ=3h-hh-h3=31⇒AB : BC=3 : 1Hence, the correct option is (1). [[VIDEO:13768]]

Question 89:

Let

tan-1y=tan-1x+tan-12×1-x2,where

x<13. Then a value of y is:

Option 1: 3x-x31-3×2
Option 2: 3x+x31-3×2
Option 3: 3x-x31+3×2
Option 4: 3x+x31+3×2
Correct Answer: 1

 

Solutions:

tan-1y=tan-1x+tan-12×1-x2

⇒tan-1y=tan-1x+2×1-x21-x×2×1-x2⇒tan-1y=tan-13x-x31-3×2⇒y=3x-x31-3x2Hence, the correct option is (1). [[VIDEO:13769]]

Question 90:

The negation of ~s â‹ (~r â‹€ s) is equivalent to :

Option 1: s â‹€ ~r
Option 2: s â‹€ (r â‹€ ~s)
Option 3: s â‹ (r ⋁ ~s)
Option 4: s â‹€ r
Correct Answer: 4

 

Solutions:~ [~s ∨ (~rs)] = ~ (~s) ∧ ~ (~rs)                    (De-Morgan’s Law) = s ∧ ( r ∨ ~s) = (sr) ∨ (s ∧ ~s) = (sr) ∨ F = sr

Hence, the correct option is (4). [[VIDEO:13770]]

Leave a Reply

Your email address will not be published.